C30H34ClN5O6S — CID 90317877
methyl 7-[(4-chlorophenyl)methyl]-6-(2-cyclopropylethylamino)-8-[5-methyl-2-(3-methylsulfonyloxypropoxy)phenyl]purine-2-carboxylate (PubChem CID 90317877) has the molecular formula C30H34ClN5O6S and a molecular weight of 628.15 g/mol. Its IUPAC name is methyl 7-[(4-chlorophenyl)methyl]-6-(2-cyclopropylethylamino)-8-[5-methyl-2-(3-methylsulfonyloxypropoxy)phenyl]purine-2-carboxylate.
| Compound Name | methyl 7-[(4-chlorophenyl)methyl]-6-(2-cyclopropylethylamino)-8-[5-methyl-2-(3-methylsulfonyloxypropoxy)phenyl]purine-2-carboxylate |
|---|---|
| PubChem CID | 90317877 |
| Molecular Formula | C30H34ClN5O6S |
| Molecular Weight | 628.15 g/mol |
| Exact Mass | 627.19 |
| IUPAC Name | methyl 7-[(4-chlorophenyl)methyl]-6-(2-cyclopropylethylamino)-8-[5-methyl-2-(3-methylsulfonyloxypropoxy)phenyl]purine-2-carboxylate |
| SMILES | COC(=O)c1nc(NCCC2CC2)c2c(n1)nc(-c1cc(C)ccc1OCCCOS(C)(=O)=O)n2Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C30H34ClN5O6S/c1-19-5-12-24(41-15-4-16-42-43(3,38)39)23(17-19)29-35-27-25(36(29)18-21-8-10-22(31)11-9-21)26(32-14-13-20-6-7-20)33-28(34-27)30(37)40-2/h5,8-12,17,20H,4,6-7,13-16,18H2,1-3H3,(H,32,33,34) |
| InChIKey | FIHAYRARLFVFRA-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 134.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.15 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|