C27H29Cl2N5O2 — CID 118558789
3-[2-[2-chloro-7-[(4-chlorophenyl)methyl]-6-[[(1R)-1-cyclopropylethyl]amino]purin-8-yl]-4-methylphenoxy]propan-1-ol (PubChem CID 118558789) has the molecular formula C27H29Cl2N5O2 and a molecular weight of 526.47 g/mol. Its IUPAC name is 3-[2-[2-chloro-7-[(4-chlorophenyl)methyl]-6-[[(1R)-1-cyclopropylethyl]amino]purin-8-yl]-4-methylphenoxy]propan-1-ol.
| Compound Name | 3-[2-[2-chloro-7-[(4-chlorophenyl)methyl]-6-[[(1R)-1-cyclopropylethyl]amino]purin-8-yl]-4-methylphenoxy]propan-1-ol |
|---|---|
| PubChem CID | 118558789 |
| Molecular Formula | C27H29Cl2N5O2 |
| Molecular Weight | 526.47 g/mol |
| Exact Mass | 525.17 |
| IUPAC Name | 3-[2-[2-chloro-7-[(4-chlorophenyl)methyl]-6-[[(1R)-1-cyclopropylethyl]amino]purin-8-yl]-4-methylphenoxy]propan-1-ol |
| SMILES | Cc1ccc(OCCCO)c(-c2nc3nc(Cl)nc(N[C@H](C)C4CC4)c3n2Cc2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C27H29Cl2N5O2/c1-16-4-11-22(36-13-3-12-35)21(14-16)26-31-25-23(34(26)15-18-5-9-20(28)10-6-18)24(32-27(29)33-25)30-17(2)19-7-8-19/h4-6,9-11,14,17,19,35H,3,7-8,12-13,15H2,1-2H3,(H,30,32,33)/t17-/m1/s1 |
| InChIKey | ZVSZOWMSUUSLRM-QGZVFWFLSA-N |
| XLogP | 6.13 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.47 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|