C27H27Cl2N5O — CID 90318492
2-chloro-7-[(4-chlorophenyl)methyl]-N-(1-cyclopropylethyl)-8-(5-methyl-2-prop-2-enoxyphenyl)purin-6-amine (PubChem CID 90318492) has the molecular formula C27H27Cl2N5O and a molecular weight of 508.45 g/mol. Its IUPAC name is 2-chloro-7-[(4-chlorophenyl)methyl]-N-(1-cyclopropylethyl)-8-(5-methyl-2-prop-2-enoxyphenyl)purin-6-amine.
| Compound Name | 2-chloro-7-[(4-chlorophenyl)methyl]-N-(1-cyclopropylethyl)-8-(5-methyl-2-prop-2-enoxyphenyl)purin-6-amine |
|---|---|
| PubChem CID | 90318492 |
| Molecular Formula | C27H27Cl2N5O |
| Molecular Weight | 508.45 g/mol |
| Exact Mass | 507.16 |
| IUPAC Name | 2-chloro-7-[(4-chlorophenyl)methyl]-N-(1-cyclopropylethyl)-8-(5-methyl-2-prop-2-enoxyphenyl)purin-6-amine |
| SMILES | C=CCOc1ccc(C)cc1-c1nc2nc(Cl)nc(NC(C)C3CC3)c2n1Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C27H27Cl2N5O/c1-4-13-35-22-12-5-16(2)14-21(22)26-31-25-23(34(26)15-18-6-10-20(28)11-7-18)24(32-27(29)33-25)30-17(3)19-8-9-19/h4-7,10-12,14,17,19H,1,8-9,13,15H2,2-3H3,(H,30,32,33) |
| InChIKey | CSZHOMSQXMXGGA-UHFFFAOYSA-N |
| XLogP | 6.93 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.45 |
| LogP ≤ 5 | 6.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|