C19H33N3O3 — CID 90319518
N-(8-hexoxyoctyl)-3-nitropyridin-4-amine (PubChem CID 90319518) has the molecular formula C19H33N3O3 and a molecular weight of 351.49 g/mol. Its IUPAC name is N-(8-hexoxyoctyl)-3-nitropyridin-4-amine.
| Compound Name | N-(8-hexoxyoctyl)-3-nitropyridin-4-amine |
|---|---|
| PubChem CID | 90319518 |
| Molecular Formula | C19H33N3O3 |
| Molecular Weight | 351.49 g/mol |
| Exact Mass | 351.25 |
| IUPAC Name | N-(8-hexoxyoctyl)-3-nitropyridin-4-amine |
| SMILES | CCCCCCOCCCCCCCCNc1ccncc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H33N3O3/c1-2-3-4-10-15-25-16-11-8-6-5-7-9-13-21-18-12-14-20-17-19(18)22(23)24/h12,14,17H,2-11,13,15-16H2,1H3,(H,20,21) |
| InChIKey | XFCFXVYPNVVINF-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 77.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.49 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|