C18H23BrFN2O+ — CID 9032194
1-adamantyl-[2-(4-bromo-2-fluoroanilino)-2-oxoethyl]azanium (PubChem CID 9032194) has the molecular formula C18H23BrFN2O+ and a molecular weight of 382.30 g/mol. Its IUPAC name is 1-adamantyl-[2-(4-bromo-2-fluoroanilino)-2-oxoethyl]azanium.
| Compound Name | 1-adamantyl-[2-(4-bromo-2-fluoroanilino)-2-oxoethyl]azanium |
|---|---|
| PubChem CID | 9032194 |
| Molecular Formula | C18H23BrFN2O+ |
| Molecular Weight | 382.30 g/mol |
| Exact Mass | 381.10 |
| IUPAC Name | 1-adamantyl-[2-(4-bromo-2-fluoroanilino)-2-oxoethyl]azanium |
| SMILES | O=C(C[NH2+]C12CC3CC(CC(C3)C1)C2)Nc1ccc(Br)cc1F |
| InChI | InChI=1S/C18H22BrFN2O/c19-14-1-2-16(15(20)6-14)22-17(23)10-21-18-7-11-3-12(8-18)5-13(4-11)9-18/h1-2,6,11-13,21H,3-5,7-10H2,(H,22,23)/p+1 |
| InChIKey | NXBJALDDQMNITP-UHFFFAOYSA-O |
| XLogP | 3.06 |
| TPSA | 45.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.30 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |