C36H34F5NO10 — CID 90322087
(2,3,4,5,6-pentafluorophenyl) (2S)-3-[(2R,3R,4S,5R,6R)-3,4-diacetyloxy-6-ethyl-5-methyloxan-2-yl]oxy-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoate (PubChem CID 90322087) has the molecular formula C36H34F5NO10 and a molecular weight of 735.65 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl) (2S)-3-[(2R,3R,4S,5R,6R)-3,4-diacetyloxy-6-ethyl-5-methyloxan-2-yl]oxy-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl) (2S)-3-[(2R,3R,4S,5R,6R)-3,4-diacetyloxy-6-ethyl-5-methyloxan-2-yl]oxy-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoate |
|---|---|
| PubChem CID | 90322087 |
| Molecular Formula | C36H34F5NO10 |
| Molecular Weight | 735.65 g/mol |
| Exact Mass | 735.21 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl) (2S)-3-[(2R,3R,4S,5R,6R)-3,4-diacetyloxy-6-ethyl-5-methyloxan-2-yl]oxy-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoate |
| SMILES | CC[C@H]1O[C@@H](OC[C@H](NC(=O)OCC2c3ccccc3-c3ccccc32)C(=O)Oc2c(F)c(F)c(F)c(F)c2F)[C@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1C |
| InChI | InChI=1S/C36H34F5NO10/c1-5-25-16(2)31(49-17(3)43)33(50-18(4)44)35(51-25)47-15-24(34(45)52-32-29(40)27(38)26(37)28(39)30(32)41)42-36(46)48-14-23-21-12-8-6-10-19(21)20-11-7-9-13-22(20)23/h6-13,16,23-25,31,33,35H,5,14-15H2,1-4H3,(H,42,46)/t16-,24+,25-,31+,33-,35-/m1/s1 |
| InChIKey | QDYMVOHQKVQXLZ-RVPUZDDQSA-N |
| XLogP | 5.85 |
| TPSA | 135.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 735.65 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|