C17H22N2O3 — CID 90323063
2-[[(1S,2S)-1-amino-2-(butoxymethyl)cyclopropyl]methyl]isoindole-1,3-dione (PubChem CID 90323063) has the molecular formula C17H22N2O3 and a molecular weight of 302.37 g/mol. Its IUPAC name is 2-[[(1S,2S)-1-amino-2-(butoxymethyl)cyclopropyl]methyl]isoindole-1,3-dione.
| Compound Name | 2-[[(1S,2S)-1-amino-2-(butoxymethyl)cyclopropyl]methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 90323063 |
| Molecular Formula | C17H22N2O3 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | 2-[[(1S,2S)-1-amino-2-(butoxymethyl)cyclopropyl]methyl]isoindole-1,3-dione |
| SMILES | CCCCOC[C@H]1C[C@@]1(N)CN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C17H22N2O3/c1-2-3-8-22-10-12-9-17(12,18)11-19-15(20)13-6-4-5-7-14(13)16(19)21/h4-7,12H,2-3,8-11,18H2,1H3/t12-,17-/m1/s1 |
| InChIKey | QIOMJMDJZLVOHK-SJKOYZFVSA-N |
| XLogP | 1.82 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|