C7H14O5S — CID 90323097
(4S)-4-(butoxymethyl)-1,3,2-dioxathiolane 2,2-dioxide (PubChem CID 90323097) has the molecular formula C7H14O5S and a molecular weight of 210.25 g/mol. Its IUPAC name is (4S)-4-(butoxymethyl)-1,3,2-dioxathiolane 2,2-dioxide.
| Compound Name | (4S)-4-(butoxymethyl)-1,3,2-dioxathiolane 2,2-dioxide |
|---|---|
| PubChem CID | 90323097 |
| Molecular Formula | C7H14O5S |
| Molecular Weight | 210.25 g/mol |
| Exact Mass | 210.06 |
| IUPAC Name | (4S)-4-(butoxymethyl)-1,3,2-dioxathiolane 2,2-dioxide |
| SMILES | CCCCOC[C@H]1COS(=O)(=O)O1 |
| InChI | InChI=1S/C7H14O5S/c1-2-3-4-10-5-7-6-11-13(8,9)12-7/h7H,2-6H2,1H3/t7-/m0/s1 |
| InChIKey | DYIDWKOGAWXMOZ-ZETCQYMHSA-N |
| XLogP | 0.46 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.25 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|