C7H10O11S2 — CID 155156503
bis[(2,2-dioxo-1,3,2-dioxathiolan-4-yl)methyl] carbonate (PubChem CID 155156503) has the molecular formula C7H10O11S2 and a molecular weight of 334.28 g/mol. Its IUPAC name is bis[(2,2-dioxo-1,3,2-dioxathiolan-4-yl)methyl] carbonate.
| Compound Name | bis[(2,2-dioxo-1,3,2-dioxathiolan-4-yl)methyl] carbonate |
|---|---|
| PubChem CID | 155156503 |
| Molecular Formula | C7H10O11S2 |
| Molecular Weight | 334.28 g/mol |
| Exact Mass | 333.97 |
| IUPAC Name | bis[(2,2-dioxo-1,3,2-dioxathiolan-4-yl)methyl] carbonate |
| SMILES | O=C(OCC1COS(=O)(=O)O1)OCC1COS(=O)(=O)O1 |
| InChI | InChI=1S/C7H10O11S2/c8-7(13-1-5-3-15-19(9,10)17-5)14-2-6-4-16-20(11,12)18-6/h5-6H,1-4H2 |
| InChIKey | SICQPMVMCDOIKS-UHFFFAOYSA-N |
| XLogP | -1.54 |
| TPSA | 140.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.28 |
| LogP ≤ 5 | -1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |