C22H26BN2O3 — CID 90325553
CID 90325553 (PubChem CID 90325553) has the molecular formula C22H26BN2O3 and a molecular weight of 377.27 g/mol.
| Compound Name | CID 90325553 |
|---|---|
| PubChem CID | 90325553 |
| Molecular Formula | C22H26BN2O3 |
| Molecular Weight | 377.27 g/mol |
| Exact Mass | 377.20 |
| IUPAC Name | — |
| SMILES | [H]/N=C/O[B][C@@H](Cc1cccc(CCC=C)c1)C(=O)N(C)c1ccc(OC)cc1 |
| InChI | InChI=1S/C22H26BN2O3/c1-4-5-7-17-8-6-9-18(14-17)15-21(23-28-16-24)22(26)25(2)19-10-12-20(27-3)13-11-19/h4,6,8-14,16,21,24H,1,5,7,15H2,2-3H3/b24-16+/t21-/m0/s1 |
| InChIKey | NNRCZKACJKUHHL-DOZBRYHWSA-N |
| XLogP | 4.05 |
| TPSA | 62.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.27 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|