C7H13N — CID 90327715
(1S,5R)-1,2-dimethyl-2-azabicyclo[3.1.0]hexane (PubChem CID 90327715) has the molecular formula C7H13N and a molecular weight of 111.19 g/mol. Its IUPAC name is (1S,5R)-1,2-dimethyl-2-azabicyclo[3.1.0]hexane.
| Compound Name | (1S,5R)-1,2-dimethyl-2-azabicyclo[3.1.0]hexane |
|---|---|
| PubChem CID | 90327715 |
| Molecular Formula | C7H13N |
| Molecular Weight | 111.19 g/mol |
| Exact Mass | 111.10 |
| IUPAC Name | (1S,5R)-1,2-dimethyl-2-azabicyclo[3.1.0]hexane |
| SMILES | CN1CC[C@@H]2C[C@@]21C |
| InChI | InChI=1S/C7H13N/c1-7-5-6(7)3-4-8(7)2/h6H,3-5H2,1-2H3/t6-,7+/m1/s1 |
| InChIKey | CWPOPPQXXUOQFW-RQJHMYQMSA-N |
| XLogP | 1.10 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 111.19 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |