C11H21N — CID 70478641
2-cyclopentyl-1,2-dimethylpyrrolidine (PubChem CID 70478641) has the molecular formula C11H21N and a molecular weight of 167.30 g/mol. Its IUPAC name is 2-cyclopentyl-1,2-dimethylpyrrolidine.
| Compound Name | 2-cyclopentyl-1,2-dimethylpyrrolidine |
|---|---|
| PubChem CID | 70478641 |
| Molecular Formula | C11H21N |
| Molecular Weight | 167.30 g/mol |
| Exact Mass | 167.17 |
| IUPAC Name | 2-cyclopentyl-1,2-dimethylpyrrolidine |
| SMILES | CN1CCCC1(C)C1CCCC1 |
| InChI | InChI=1S/C11H21N/c1-11(8-5-9-12(11)2)10-6-3-4-7-10/h10H,3-9H2,1-2H3 |
| InChIKey | UGAOCPVGPZMJTD-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.30 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |