C18H33N — CID 175836886
2,3-dicyclopentyl-1,2-dimethylazepane (PubChem CID 175836886) has the molecular formula C18H33N and a molecular weight of 263.47 g/mol. Its IUPAC name is 2,3-dicyclopentyl-1,2-dimethylazepane.
| Compound Name | 2,3-dicyclopentyl-1,2-dimethylazepane |
|---|---|
| PubChem CID | 175836886 |
| Molecular Formula | C18H33N |
| Molecular Weight | 263.47 g/mol |
| Exact Mass | 263.26 |
| IUPAC Name | 2,3-dicyclopentyl-1,2-dimethylazepane |
| SMILES | CN1CCCCC(C2CCCC2)C1(C)C1CCCC1 |
| InChI | InChI=1S/C18H33N/c1-18(16-11-5-6-12-16)17(15-9-3-4-10-15)13-7-8-14-19(18)2/h15-17H,3-14H2,1-2H3 |
| InChIKey | KELHVDXOJTVMRQ-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.47 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |