C14H27N — CID 162435864
4-cyclohexyl-1,2,2,4-tetramethylpyrrolidine (PubChem CID 162435864) has the molecular formula C14H27N and a molecular weight of 209.38 g/mol. Its IUPAC name is 4-cyclohexyl-1,2,2,4-tetramethylpyrrolidine.
| Compound Name | 4-cyclohexyl-1,2,2,4-tetramethylpyrrolidine |
|---|---|
| PubChem CID | 162435864 |
| Molecular Formula | C14H27N |
| Molecular Weight | 209.38 g/mol |
| Exact Mass | 209.21 |
| IUPAC Name | 4-cyclohexyl-1,2,2,4-tetramethylpyrrolidine |
| SMILES | CN1CC(C)(C2CCCCC2)CC1(C)C |
| InChI | InChI=1S/C14H27N/c1-13(2)10-14(3,11-15(13)4)12-8-6-5-7-9-12/h12H,5-11H2,1-4H3 |
| InChIKey | URRRYEPHTUGPOE-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.38 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |