C11H20O2 — CID 70232095
5-cyclohexyl-5-methyl-1,3-dioxane (PubChem CID 70232095) has the molecular formula C11H20O2 and a molecular weight of 184.28 g/mol. Its IUPAC name is 5-cyclohexyl-5-methyl-1,3-dioxane.
| Compound Name | 5-cyclohexyl-5-methyl-1,3-dioxane |
|---|---|
| PubChem CID | 70232095 |
| Molecular Formula | C11H20O2 |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.15 |
| IUPAC Name | 5-cyclohexyl-5-methyl-1,3-dioxane |
| SMILES | CC1(C2CCCCC2)COCOC1 |
| InChI | InChI=1S/C11H20O2/c1-11(7-12-9-13-8-11)10-5-3-2-4-6-10/h10H,2-9H2,1H3 |
| InChIKey | HLLYLMWIGAESBQ-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |