C28H53NO — CID 167156556
7-(3,3-dimethylcyclododecyl)-5,7,9,9,10,10-hexamethyl-2-oxa-5-azaspiro[3.6]decane (PubChem CID 167156556) has the molecular formula C28H53NO and a molecular weight of 419.74 g/mol. Its IUPAC name is 7-(3,3-dimethylcyclododecyl)-5,7,9,9,10,10-hexamethyl-2-oxa-5-azaspiro[3.6]decane.
| Compound Name | 7-(3,3-dimethylcyclododecyl)-5,7,9,9,10,10-hexamethyl-2-oxa-5-azaspiro[3.6]decane |
|---|---|
| PubChem CID | 167156556 |
| Molecular Formula | C28H53NO |
| Molecular Weight | 419.74 g/mol |
| Exact Mass | 419.41 |
| IUPAC Name | 7-(3,3-dimethylcyclododecyl)-5,7,9,9,10,10-hexamethyl-2-oxa-5-azaspiro[3.6]decane |
| SMILES | CN1CC(C)(C2CCCCCCCCCC(C)(C)C2)CC(C)(C)C(C)(C)C12COC2 |
| InChI | InChI=1S/C28H53NO/c1-24(2)17-15-13-11-9-10-12-14-16-23(18-24)27(7)19-25(3,4)26(5,6)28(21-30-22-28)29(8)20-27/h23H,9-22H2,1-8H3 |
| InChIKey | RTNVAXASJSAQQX-UHFFFAOYSA-N |
| XLogP | 7.71 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.74 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |