C14H29NO — CID 123660579
3,3,5,6,6,8,8-heptamethyl-1,5-oxazonane (PubChem CID 123660579) has the molecular formula C14H29NO and a molecular weight of 227.39 g/mol. Its IUPAC name is 3,3,5,6,6,8,8-heptamethyl-1,5-oxazonane.
| Compound Name | 3,3,5,6,6,8,8-heptamethyl-1,5-oxazonane |
|---|---|
| PubChem CID | 123660579 |
| Molecular Formula | C14H29NO |
| Molecular Weight | 227.39 g/mol |
| Exact Mass | 227.22 |
| IUPAC Name | 3,3,5,6,6,8,8-heptamethyl-1,5-oxazonane |
| SMILES | CN1CC(C)(C)COCC(C)(C)CC1(C)C |
| InChI | InChI=1S/C14H29NO/c1-12(2)8-14(5,6)15(7)9-13(3,4)11-16-10-12/h8-11H2,1-7H3 |
| InChIKey | FVPTUMXMJMEIBI-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.39 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |