C16H30N2O2 — CID 22983332
1,2,2,9,10,10-hexamethyl-4,12-dioxa-1,9-diazadispiro[4.2.48.25]tetradecane (PubChem CID 22983332) has the molecular formula C16H30N2O2 and a molecular weight of 282.43 g/mol. Its IUPAC name is 1,2,2,9,10,10-hexamethyl-4,12-dioxa-1,9-diazadispiro[4.2.48.25]tetradecane.
| Compound Name | 1,2,2,9,10,10-hexamethyl-4,12-dioxa-1,9-diazadispiro[4.2.48.25]tetradecane |
|---|---|
| PubChem CID | 22983332 |
| Molecular Formula | C16H30N2O2 |
| Molecular Weight | 282.43 g/mol |
| Exact Mass | 282.23 |
| IUPAC Name | 1,2,2,9,10,10-hexamethyl-4,12-dioxa-1,9-diazadispiro[4.2.48.25]tetradecane |
| SMILES | CN1C(C)(C)COC12CCC1(CC2)OCC(C)(C)N1C |
| InChI | InChI=1S/C16H30N2O2/c1-13(2)11-19-15(17(13)5)7-9-16(10-8-15)18(6)14(3,4)12-20-16/h7-12H2,1-6H3 |
| InChIKey | GBLAQYGZJQUBNJ-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.43 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |