C29H54N2O4 — CID 135254045
1,2,2,3,4,4,5,13,14,14,15,16,16,17-tetradecamethyl-7,11,18,21-tetraoxa-3,15-diazatrispiro[5.2.2.512.29.26]henicosane (PubChem CID 135254045) has the molecular formula C29H54N2O4 and a molecular weight of 494.76 g/mol. Its IUPAC name is 1,2,2,3,4,4,5,13,14,14,15,16,16,17-tetradecamethyl-7,11,18,21-tetraoxa-3,15-diazatrispiro[5.2.2.512.29.26]henicosane.
| Compound Name | 1,2,2,3,4,4,5,13,14,14,15,16,16,17-tetradecamethyl-7,11,18,21-tetraoxa-3,15-diazatrispiro[5.2.2.512.29.26]henicosane |
|---|---|
| PubChem CID | 135254045 |
| Molecular Formula | C29H54N2O4 |
| Molecular Weight | 494.76 g/mol |
| Exact Mass | 494.41 |
| IUPAC Name | 1,2,2,3,4,4,5,13,14,14,15,16,16,17-tetradecamethyl-7,11,18,21-tetraoxa-3,15-diazatrispiro[5.2.2.512.29.26]henicosane |
| SMILES | CC1C2(OCC3(CO2)COC2(OC3)C(C)C(C)(C)N(C)C(C)(C)C2C)C(C)C(C)(C)N(C)C1(C)C |
| InChI | InChI=1S/C29H54N2O4/c1-19-23(5,6)30(13)24(7,8)20(2)28(19)32-15-27(16-33-28)17-34-29(35-18-27)21(3)25(9,10)31(14)26(11,12)22(29)4/h19-22H,15-18H2,1-14H3 |
| InChIKey | JHSCLWOMXVMNMF-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 43.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.76 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |