C7H14O3 — CID 145482974
7,7-dimethyl-1,3,5-trioxocane (PubChem CID 145482974) has the molecular formula C7H14O3 and a molecular weight of 146.19 g/mol. Its IUPAC name is 7,7-dimethyl-1,3,5-trioxocane.
| Compound Name | 7,7-dimethyl-1,3,5-trioxocane |
|---|---|
| PubChem CID | 145482974 |
| Molecular Formula | C7H14O3 |
| Molecular Weight | 146.19 g/mol |
| Exact Mass | 146.09 |
| IUPAC Name | 7,7-dimethyl-1,3,5-trioxocane |
| SMILES | CC1(C)COCOCOC1 |
| InChI | InChI=1S/C7H14O3/c1-7(2)3-8-5-10-6-9-4-7/h3-6H2,1-2H3 |
| InChIKey | KQMXDQWUFOZPMA-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.19 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |