C12H20N2O4S4Zn — CID 134122883
zinc bis(N-(5-methyl-1,3-dioxan-5-yl)carbamodithioate) (PubChem CID 134122883) has the molecular formula C12H20N2O4S4Zn and a molecular weight of 449.96 g/mol. Its IUPAC name is zinc bis(N-(5-methyl-1,3-dioxan-5-yl)carbamodithioate).
| Compound Name | zinc bis(N-(5-methyl-1,3-dioxan-5-yl)carbamodithioate) |
|---|---|
| PubChem CID | 134122883 |
| Molecular Formula | C12H20N2O4S4Zn |
| Molecular Weight | 449.96 g/mol |
| Exact Mass | 447.96 |
| IUPAC Name | zinc bis(N-(5-methyl-1,3-dioxan-5-yl)carbamodithioate) |
| SMILES | CC1(NC(=S)[S-])COCOC1.CC1(NC(=S)[S-])COCOC1.[Zn+2] |
| InChI | InChI=1S/2C6H11NO2S2.Zn/c2*1-6(7-5(10)11)2-8-4-9-3-6;/h2*2-4H2,1H3,(H2,7,10,11);/q;;+2/p-2 |
| InChIKey | NDPMEZOYQUOSHU-UHFFFAOYSA-L |
| XLogP | 0.34 |
| TPSA | 60.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.96 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|