C23H26O2S — CID 90335576
2-(2-ethylphenyl)-3-hydroxy-5-[2-(4-methylphenyl)sulfanylethyl]cyclohex-2-en-1-one (PubChem CID 90335576) has the molecular formula C23H26O2S and a molecular weight of 366.53 g/mol. Its IUPAC name is 2-(2-ethylphenyl)-3-hydroxy-5-[2-(4-methylphenyl)sulfanylethyl]cyclohex-2-en-1-one.
| Compound Name | 2-(2-ethylphenyl)-3-hydroxy-5-[2-(4-methylphenyl)sulfanylethyl]cyclohex-2-en-1-one |
|---|---|
| PubChem CID | 90335576 |
| Molecular Formula | C23H26O2S |
| Molecular Weight | 366.53 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | 2-(2-ethylphenyl)-3-hydroxy-5-[2-(4-methylphenyl)sulfanylethyl]cyclohex-2-en-1-one |
| SMILES | CCc1ccccc1C1=C(O)CC(CCSc2ccc(C)cc2)CC1=O |
| InChI | InChI=1S/C23H26O2S/c1-3-18-6-4-5-7-20(18)23-21(24)14-17(15-22(23)25)12-13-26-19-10-8-16(2)9-11-19/h4-11,17,24H,3,12-15H2,1-2H3 |
| InChIKey | KCZVSDPEKYBTKQ-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.53 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |