C19H22F3NO3S — CID 135816663
2-[(E)-N-ethoxy-C-methylcarbonimidoyl]-3-hydroxy-5-[2-[4-(trifluoromethyl)phenyl]sulfanylethyl]cyclohex-2-en-1-one (PubChem CID 135816663) has the molecular formula C19H22F3NO3S and a molecular weight of 401.45 g/mol. Its IUPAC name is 2-[(E)-N-ethoxy-C-methylcarbonimidoyl]-3-hydroxy-5-[2-[4-(trifluoromethyl)phenyl]sulfanylethyl]cyclohex-2-en-1-one.
| Compound Name | 2-[(E)-N-ethoxy-C-methylcarbonimidoyl]-3-hydroxy-5-[2-[4-(trifluoromethyl)phenyl]sulfanylethyl]cyclohex-2-en-1-one |
|---|---|
| PubChem CID | 135816663 |
| Molecular Formula | C19H22F3NO3S |
| Molecular Weight | 401.45 g/mol |
| Exact Mass | 401.13 |
| IUPAC Name | 2-[(E)-N-ethoxy-C-methylcarbonimidoyl]-3-hydroxy-5-[2-[4-(trifluoromethyl)phenyl]sulfanylethyl]cyclohex-2-en-1-one |
| SMILES | CCO/N=C(\C)C1=C(O)CC(CCSc2ccc(C(F)(F)F)cc2)CC1=O |
| InChI | InChI=1S/C19H22F3NO3S/c1-3-26-23-12(2)18-16(24)10-13(11-17(18)25)8-9-27-15-6-4-14(5-7-15)19(20,21)22/h4-7,13,24H,3,8-11H2,1-2H3/b23-12+ |
| InChIKey | DVSUCQGFIWDDME-FSJBWODESA-N |
| XLogP | 5.39 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.45 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|