C29H39N3O2 — CID 90335812
[2-pyridin-3-yl-1-(2,5,8-trimethyl-3,4-dihydro-1H-pyrido[4,3-b]indol-6-yl)propan-2-yl] 2,4-dimethylpentanoate (PubChem CID 90335812) has the molecular formula C29H39N3O2 and a molecular weight of 461.65 g/mol. Its IUPAC name is [2-pyridin-3-yl-1-(2,5,8-trimethyl-3,4-dihydro-1H-pyrido[4,3-b]indol-6-yl)propan-2-yl] 2,4-dimethylpentanoate.
| Compound Name | [2-pyridin-3-yl-1-(2,5,8-trimethyl-3,4-dihydro-1H-pyrido[4,3-b]indol-6-yl)propan-2-yl] 2,4-dimethylpentanoate |
|---|---|
| PubChem CID | 90335812 |
| Molecular Formula | C29H39N3O2 |
| Molecular Weight | 461.65 g/mol |
| Exact Mass | 461.30 |
| IUPAC Name | [2-pyridin-3-yl-1-(2,5,8-trimethyl-3,4-dihydro-1H-pyrido[4,3-b]indol-6-yl)propan-2-yl] 2,4-dimethylpentanoate |
| SMILES | Cc1cc(CC(C)(OC(=O)C(C)CC(C)C)c2cccnc2)c2c(c1)c1c(n2C)CCN(C)C1 |
| InChI | InChI=1S/C29H39N3O2/c1-19(2)13-21(4)28(33)34-29(5,23-9-8-11-30-17-23)16-22-14-20(3)15-24-25-18-31(6)12-10-26(25)32(7)27(22)24/h8-9,11,14-15,17,19,21H,10,12-13,16,18H2,1-7H3 |
| InChIKey | PJAYHMSOVKPSFM-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.65 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|