C19H20N4O — CID 90336064
N-(1H-benzimidazol-2-yl)-2-[4-(dimethylamino)phenyl]cyclopropane-1-carboxamide (PubChem CID 90336064) has the molecular formula C19H20N4O and a molecular weight of 320.40 g/mol. Its IUPAC name is N-(1H-benzimidazol-2-yl)-2-[4-(dimethylamino)phenyl]cyclopropane-1-carboxamide.
| Compound Name | N-(1H-benzimidazol-2-yl)-2-[4-(dimethylamino)phenyl]cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 90336064 |
| Molecular Formula | C19H20N4O |
| Molecular Weight | 320.40 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | N-(1H-benzimidazol-2-yl)-2-[4-(dimethylamino)phenyl]cyclopropane-1-carboxamide |
| SMILES | CN(C)c1ccc(C2CC2C(=O)Nc2nc3ccccc3[nH]2)cc1 |
| InChI | InChI=1S/C19H20N4O/c1-23(2)13-9-7-12(8-10-13)14-11-15(14)18(24)22-19-20-16-5-3-4-6-17(16)21-19/h3-10,14-15H,11H2,1-2H3,(H2,20,21,22,24) |
| InChIKey | SIIYTQYZZVNIND-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.40 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|