C17H25NO2 — CID 90337055
N-[3-(3,3-dideuterio-1-hydroxybutyl)phenyl]cyclohexanecarboxamide (PubChem CID 90337055) has the molecular formula C17H25NO2 and a molecular weight of 277.40 g/mol. Its IUPAC name is N-[3-(3,3-dideuterio-1-hydroxybutyl)phenyl]cyclohexanecarboxamide.
| Compound Name | N-[3-(3,3-dideuterio-1-hydroxybutyl)phenyl]cyclohexanecarboxamide |
|---|---|
| PubChem CID | 90337055 |
| Molecular Formula | C17H25NO2 |
| Molecular Weight | 277.40 g/mol |
| Exact Mass | 277.20 |
| IUPAC Name | N-[3-(3,3-dideuterio-1-hydroxybutyl)phenyl]cyclohexanecarboxamide |
| SMILES | [2H]C([2H])(C)CC(O)c1cccc(NC(=O)C2CCCCC2)c1 |
| InChI | InChI=1S/C17H25NO2/c1-2-7-16(19)14-10-6-11-15(12-14)18-17(20)13-8-4-3-5-9-13/h6,10-13,16,19H,2-5,7-9H2,1H3,(H,18,20)/i2D2 |
| InChIKey | ZRYZMVPFCDMBTN-CBTSVUPCSA-N |
| XLogP | 4.04 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.40 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |