C20H31N7O3S — CID 90338243
6-(cyclobutylmethylamino)-7-(cyclohexylmethyl)-N-(dimethylsulfamoyl)purine-2-carboxamide (PubChem CID 90338243) has the molecular formula C20H31N7O3S and a molecular weight of 449.58 g/mol. Its IUPAC name is 6-(cyclobutylmethylamino)-7-(cyclohexylmethyl)-N-(dimethylsulfamoyl)purine-2-carboxamide.
| Compound Name | 6-(cyclobutylmethylamino)-7-(cyclohexylmethyl)-N-(dimethylsulfamoyl)purine-2-carboxamide |
|---|---|
| PubChem CID | 90338243 |
| Molecular Formula | C20H31N7O3S |
| Molecular Weight | 449.58 g/mol |
| Exact Mass | 449.22 |
| IUPAC Name | 6-(cyclobutylmethylamino)-7-(cyclohexylmethyl)-N-(dimethylsulfamoyl)purine-2-carboxamide |
| SMILES | CN(C)S(=O)(=O)NC(=O)c1nc(NCC2CCC2)c2c(ncn2CC2CCCCC2)n1 |
| InChI | InChI=1S/C20H31N7O3S/c1-26(2)31(29,30)25-20(28)19-23-17(21-11-14-9-6-10-14)16-18(24-19)22-13-27(16)12-15-7-4-3-5-8-15/h13-15H,3-12H2,1-2H3,(H,25,28)(H,21,23,24) |
| InChIKey | HGFFWRGUVALNHE-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 122.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.58 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |