C32H30Cl2F4N2O4S — CID 90342083
N-[(2S)-2-[(2R,3R,6S)-2-(3-chlorophenyl)-3-(4-chlorophenyl)-5-oxo-6-prop-2-enylmorpholin-4-yl]-4,4,4-trifluorobutyl]-1-(2-fluorophenyl)cyclopropane-1-sulfonamide (PubChem CID 90342083) has the molecular formula C32H30Cl2F4N2O4S and a molecular weight of 685.57 g/mol. Its IUPAC name is N-[(2S)-2-[(2R,3R,6S)-2-(3-chlorophenyl)-3-(4-chlorophenyl)-5-oxo-6-prop-2-enylmorpholin-4-yl]-4,4,4-trifluorobutyl]-1-(2-fluorophenyl)cyclopropane-1-sulfonamide.
| Compound Name | N-[(2S)-2-[(2R,3R,6S)-2-(3-chlorophenyl)-3-(4-chlorophenyl)-5-oxo-6-prop-2-enylmorpholin-4-yl]-4,4,4-trifluorobutyl]-1-(2-fluorophenyl)cyclopropane-1-sulfonamide |
|---|---|
| PubChem CID | 90342083 |
| Molecular Formula | C32H30Cl2F4N2O4S |
| Molecular Weight | 685.57 g/mol |
| Exact Mass | 684.12 |
| IUPAC Name | N-[(2S)-2-[(2R,3R,6S)-2-(3-chlorophenyl)-3-(4-chlorophenyl)-5-oxo-6-prop-2-enylmorpholin-4-yl]-4,4,4-trifluorobutyl]-1-(2-fluorophenyl)cyclopropane-1-sulfonamide |
| SMILES | C=CC[C@@H]1O[C@H](c2cccc(Cl)c2)[C@@H](c2ccc(Cl)cc2)N([C@H](CNS(=O)(=O)C2(c3ccccc3F)CC2)CC(F)(F)F)C1=O |
| InChI | InChI=1S/C32H30Cl2F4N2O4S/c1-2-6-27-30(41)40(28(20-11-13-22(33)14-12-20)29(44-27)21-7-5-8-23(34)17-21)24(18-32(36,37)38)19-39-45(42,43)31(15-16-31)25-9-3-4-10-26(25)35/h2-5,7-14,17,24,27-29,39H,1,6,15-16,18-19H2/t24-,27-,28+,29+/m0/s1 |
| InChIKey | NSVCJTILWBRJQZ-BENTYHEHSA-N |
| XLogP | 7.65 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.57 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|