C12H5Cl4NO2S — CID 90344337
1,3-dichloro-5-(2,6-dichlorophenyl)sulfanyl-2-nitrobenzene (PubChem CID 90344337) has the molecular formula C12H5Cl4NO2S and a molecular weight of 369.06 g/mol. Its IUPAC name is 1,3-dichloro-5-(2,6-dichlorophenyl)sulfanyl-2-nitrobenzene.
| Compound Name | 1,3-dichloro-5-(2,6-dichlorophenyl)sulfanyl-2-nitrobenzene |
|---|---|
| PubChem CID | 90344337 |
| Molecular Formula | C12H5Cl4NO2S |
| Molecular Weight | 369.06 g/mol |
| Exact Mass | 366.88 |
| IUPAC Name | 1,3-dichloro-5-(2,6-dichlorophenyl)sulfanyl-2-nitrobenzene |
| SMILES | O=[N+]([O-])c1c(Cl)cc(Sc2c(Cl)cccc2Cl)cc1Cl |
| InChI | InChI=1S/C12H5Cl4NO2S/c13-7-2-1-3-8(14)12(7)20-6-4-9(15)11(17(18)19)10(16)5-6/h1-5H |
| InChIKey | GTXBXOAOKZBKCP-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.06 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|