C15H18N2O3 — CID 90344395
tert-butyl 3-hydroxy-3-(2-pyridin-2-ylethynyl)azetidine-1-carboxylate (PubChem CID 90344395) has the molecular formula C15H18N2O3 and a molecular weight of 274.32 g/mol. Its IUPAC name is tert-butyl 3-hydroxy-3-(2-pyridin-2-ylethynyl)azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-hydroxy-3-(2-pyridin-2-ylethynyl)azetidine-1-carboxylate |
|---|---|
| PubChem CID | 90344395 |
| Molecular Formula | C15H18N2O3 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | tert-butyl 3-hydroxy-3-(2-pyridin-2-ylethynyl)azetidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(O)(C#Cc2ccccn2)C1 |
| InChI | InChI=1S/C15H18N2O3/c1-14(2,3)20-13(18)17-10-15(19,11-17)8-7-12-6-4-5-9-16-12/h4-6,9,19H,10-11H2,1-3H3 |
| InChIKey | FECILZNGOUBUBZ-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|