C12H14FN3O3 — CID 90344506
ethyl (2E)-2-amino-2-[[2-(3-fluorophenyl)acetyl]hydrazinylidene]acetate (PubChem CID 90344506) has the molecular formula C12H14FN3O3 and a molecular weight of 267.26 g/mol. Its IUPAC name is ethyl (2E)-2-amino-2-[[2-(3-fluorophenyl)acetyl]hydrazinylidene]acetate.
| Compound Name | ethyl (2E)-2-amino-2-[[2-(3-fluorophenyl)acetyl]hydrazinylidene]acetate |
|---|---|
| PubChem CID | 90344506 |
| Molecular Formula | C12H14FN3O3 |
| Molecular Weight | 267.26 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | ethyl (2E)-2-amino-2-[[2-(3-fluorophenyl)acetyl]hydrazinylidene]acetate |
| SMILES | CCOC(=O)/C(N)=N\NC(=O)Cc1cccc(F)c1 |
| InChI | InChI=1S/C12H14FN3O3/c1-2-19-12(18)11(14)16-15-10(17)7-8-4-3-5-9(13)6-8/h3-6H,2,7H2,1H3,(H2,14,16)(H,15,17) |
| InChIKey | WNMMKCWUDGKINQ-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 93.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.26 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|