C20H27N3O5 — CID 90345350
butyl 4-[[2-(butoxycarbonylamino)-3-cyanopropanoyl]amino]benzoate (PubChem CID 90345350) has the molecular formula C20H27N3O5 and a molecular weight of 389.45 g/mol. Its IUPAC name is butyl 4-[[2-(butoxycarbonylamino)-3-cyanopropanoyl]amino]benzoate.
| Compound Name | butyl 4-[[2-(butoxycarbonylamino)-3-cyanopropanoyl]amino]benzoate |
|---|---|
| PubChem CID | 90345350 |
| Molecular Formula | C20H27N3O5 |
| Molecular Weight | 389.45 g/mol |
| Exact Mass | 389.20 |
| IUPAC Name | butyl 4-[[2-(butoxycarbonylamino)-3-cyanopropanoyl]amino]benzoate |
| SMILES | CCCCOC(=O)NC(CC#N)C(=O)Nc1ccc(C(=O)OCCCC)cc1 |
| InChI | InChI=1S/C20H27N3O5/c1-3-5-13-27-19(25)15-7-9-16(10-8-15)22-18(24)17(11-12-21)23-20(26)28-14-6-4-2/h7-10,17H,3-6,11,13-14H2,1-2H3,(H,22,24)(H,23,26) |
| InChIKey | KSNDMKSIULWEBZ-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 117.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.45 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|