C14H18N2O4 — CID 90349208
4-[[(2S,3R)-2-amino-3-prop-2-enoxybutanoyl]amino]benzoic acid (PubChem CID 90349208) has the molecular formula C14H18N2O4 and a molecular weight of 278.31 g/mol. Its IUPAC name is 4-[[(2S,3R)-2-amino-3-prop-2-enoxybutanoyl]amino]benzoic acid.
| Compound Name | 4-[[(2S,3R)-2-amino-3-prop-2-enoxybutanoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 90349208 |
| Molecular Formula | C14H18N2O4 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | 4-[[(2S,3R)-2-amino-3-prop-2-enoxybutanoyl]amino]benzoic acid |
| SMILES | C=CCO[C@H](C)[C@H](N)C(=O)Nc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C14H18N2O4/c1-3-8-20-9(2)12(15)13(17)16-11-6-4-10(5-7-11)14(18)19/h3-7,9,12H,1,8,15H2,2H3,(H,16,17)(H,18,19)/t9-,12+/m1/s1 |
| InChIKey | VBCPXDOZJPQICX-SKDRFNHKSA-N |
| XLogP | 1.24 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|