C21H17ClN2O2 — CID 90352685
3-(2-chloro-6-methylphenyl)-N-(3-ethynylphenyl)-N,5-dimethyl-1,2-oxazole-4-carboxamide (PubChem CID 90352685) has the molecular formula C21H17ClN2O2 and a molecular weight of 364.83 g/mol. Its IUPAC name is 3-(2-chloro-6-methylphenyl)-N-(3-ethynylphenyl)-N,5-dimethyl-1,2-oxazole-4-carboxamide.
| Compound Name | 3-(2-chloro-6-methylphenyl)-N-(3-ethynylphenyl)-N,5-dimethyl-1,2-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 90352685 |
| Molecular Formula | C21H17ClN2O2 |
| Molecular Weight | 364.83 g/mol |
| Exact Mass | 364.10 |
| IUPAC Name | 3-(2-chloro-6-methylphenyl)-N-(3-ethynylphenyl)-N,5-dimethyl-1,2-oxazole-4-carboxamide |
| SMILES | C#Cc1cccc(N(C)C(=O)c2c(-c3c(C)cccc3Cl)noc2C)c1 |
| InChI | InChI=1S/C21H17ClN2O2/c1-5-15-9-7-10-16(12-15)24(4)21(25)19-14(3)26-23-20(19)18-13(2)8-6-11-17(18)22/h1,6-12H,2-4H3 |
| InChIKey | MTKXQOAGAQTVGB-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.83 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|