C13H22O9S2 — CID 90352884
(2S,4R,5R)-6-[(1R)-2-acetyloxy-1-hydroxyethyl]-2-[(ethyldisulfanyl)methoxy]-4,5-dihydroxyoxane-2-carboxylic acid (PubChem CID 90352884) has the molecular formula C13H22O9S2 and a molecular weight of 386.44 g/mol. Its IUPAC name is (2S,4R,5R)-6-[(1R)-2-acetyloxy-1-hydroxyethyl]-2-[(ethyldisulfanyl)methoxy]-4,5-dihydroxyoxane-2-carboxylic acid.
| Compound Name | (2S,4R,5R)-6-[(1R)-2-acetyloxy-1-hydroxyethyl]-2-[(ethyldisulfanyl)methoxy]-4,5-dihydroxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 90352884 |
| Molecular Formula | C13H22O9S2 |
| Molecular Weight | 386.44 g/mol |
| Exact Mass | 386.07 |
| IUPAC Name | (2S,4R,5R)-6-[(1R)-2-acetyloxy-1-hydroxyethyl]-2-[(ethyldisulfanyl)methoxy]-4,5-dihydroxyoxane-2-carboxylic acid |
| SMILES | CCSSCO[C@]1(C(=O)O)C[C@@H](O)[C@@H](O)C([C@H](O)COC(C)=O)O1 |
| InChI | InChI=1S/C13H22O9S2/c1-3-23-24-6-21-13(12(18)19)4-8(15)10(17)11(22-13)9(16)5-20-7(2)14/h8-11,15-17H,3-6H2,1-2H3,(H,18,19)/t8-,9-,10-,11?,13-/m1/s1 |
| InChIKey | CFWNGBFXUHIBIB-HEMLXDJJSA-N |
| XLogP | -0.42 |
| TPSA | 142.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.44 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|