C17H21NO4S — CID 903536
propan-2-yl 4-ethyl-5-methyl-2-[(2-methylfuran-3-carbonyl)amino]thiophene-3-carboxylate (PubChem CID 903536) has the molecular formula C17H21NO4S and a molecular weight of 335.43 g/mol. Its IUPAC name is propan-2-yl 4-ethyl-5-methyl-2-[(2-methylfuran-3-carbonyl)amino]thiophene-3-carboxylate.
| Compound Name | propan-2-yl 4-ethyl-5-methyl-2-[(2-methylfuran-3-carbonyl)amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 903536 |
| Molecular Formula | C17H21NO4S |
| Molecular Weight | 335.43 g/mol |
| Exact Mass | 335.12 |
| IUPAC Name | propan-2-yl 4-ethyl-5-methyl-2-[(2-methylfuran-3-carbonyl)amino]thiophene-3-carboxylate |
| SMILES | CCc1c(C)sc(NC(=O)c2ccoc2C)c1C(=O)OC(C)C |
| InChI | InChI=1S/C17H21NO4S/c1-6-12-11(5)23-16(14(12)17(20)22-9(2)3)18-15(19)13-7-8-21-10(13)4/h7-9H,6H2,1-5H3,(H,18,19) |
| InChIKey | SOXRPDHXPGUIEH-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.43 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |