C12H16N2O2 — CID 90356055
methyl 1-propan-2-yl-2,3-dihydroindazole-5-carboxylate (PubChem CID 90356055) has the molecular formula C12H16N2O2 and a molecular weight of 220.27 g/mol. Its IUPAC name is methyl 1-propan-2-yl-2,3-dihydroindazole-5-carboxylate.
| Compound Name | methyl 1-propan-2-yl-2,3-dihydroindazole-5-carboxylate |
|---|---|
| PubChem CID | 90356055 |
| Molecular Formula | C12H16N2O2 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.12 |
| IUPAC Name | methyl 1-propan-2-yl-2,3-dihydroindazole-5-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)CNN2C(C)C |
| InChI | InChI=1S/C12H16N2O2/c1-8(2)14-11-5-4-9(12(15)16-3)6-10(11)7-13-14/h4-6,8,13H,7H2,1-3H3 |
| InChIKey | UZIPNAQVOZNBFZ-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |