C25H27NO2 — CID 90358689
(8S,9S,13S,14S)-1,13-dimethyl-17-pyridin-3-yl-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthrene-3-carboxylic acid (PubChem CID 90358689) has the molecular formula C25H27NO2 and a molecular weight of 373.50 g/mol. Its IUPAC name is (8S,9S,13S,14S)-1,13-dimethyl-17-pyridin-3-yl-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthrene-3-carboxylic acid.
| Compound Name | (8S,9S,13S,14S)-1,13-dimethyl-17-pyridin-3-yl-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthrene-3-carboxylic acid |
|---|---|
| PubChem CID | 90358689 |
| Molecular Formula | C25H27NO2 |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.20 |
| IUPAC Name | (8S,9S,13S,14S)-1,13-dimethyl-17-pyridin-3-yl-6,7,8,9,11,12,14,15-octahydrocyclopenta[a]phenanthrene-3-carboxylic acid |
| SMILES | Cc1cc(C(=O)O)cc2c1[C@H]1CC[C@]3(C)C(c4cccnc4)=CC[C@H]3[C@@H]1CC2 |
| InChI | InChI=1S/C25H27NO2/c1-15-12-18(24(27)28)13-16-5-6-19-20(23(15)16)9-10-25(2)21(7-8-22(19)25)17-4-3-11-26-14-17/h3-4,7,11-14,19-20,22H,5-6,8-10H2,1-2H3,(H,27,28)/t19-,20+,22+,25-/m1/s1 |
| InChIKey | OZSPGOKXTXSPNJ-QIRSKFFZSA-N |
| XLogP | 5.64 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |