C27H38N2O2S — CID 118523834
(2S,8R,9S,10R,13S,14S)-10,13-dimethyl-17-pyridin-3-yl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-2-amine;3-sulfanylpropanoic acid (PubChem CID 118523834) has the molecular formula C27H38N2O2S and a molecular weight of 454.68 g/mol. Its IUPAC name is (2S,8R,9S,10R,13S,14S)-10,13-dimethyl-17-pyridin-3-yl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-2-amine;3-sulfanylpropanoic acid.
| Compound Name | (2S,8R,9S,10R,13S,14S)-10,13-dimethyl-17-pyridin-3-yl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-2-amine;3-sulfanylpropanoic acid |
|---|---|
| PubChem CID | 118523834 |
| Molecular Formula | C27H38N2O2S |
| Molecular Weight | 454.68 g/mol |
| Exact Mass | 454.27 |
| IUPAC Name | (2S,8R,9S,10R,13S,14S)-10,13-dimethyl-17-pyridin-3-yl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-2-amine;3-sulfanylpropanoic acid |
| SMILES | C[C@]12C[C@@H](N)CCC1=CC[C@@H]1[C@@H]2CC[C@]2(C)C(c3cccnc3)=CC[C@@H]12.O=C(O)CCS |
| InChI | InChI=1S/C24H32N2.C3H6O2S/c1-23-12-11-22-19(8-6-17-5-7-18(25)14-24(17,22)2)21(23)10-9-20(23)16-4-3-13-26-15-16;4-3(5)1-2-6/h3-4,6,9,13,15,18-19,21-22H,5,7-8,10-12,14,25H2,1-2H3;6H,1-2H2,(H,4,5)/t18-,19-,21-,22-,23+,24-;/m0./s1 |
| InChIKey | HCIJMOSHAXDBTC-LGSIKREPSA-N |
| XLogP | 5.76 |
| TPSA | 76.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.68 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|