About 2-methylsulfanylethyl N-methyl-N-(1-methyl-3-pyridin-3-ylpyrazol-5-yl)carbamate
2-methylsulfanylethyl N-methyl-N-(1-methyl-3-pyridin-3-ylpyrazol-5-yl)carbamate (PubChem CID 90359753) has the molecular formula C14H18N4O2S
and a molecular weight of 306.39 g/mol. Its IUPAC name is 2-methylsulfanylethyl N-methyl-N-(1-methyl-3-pyridin-3-ylpyrazol-5-yl)carbamate.
Molecular Properties
| Compound Name | 2-methylsulfanylethyl N-methyl-N-(1-methyl-3-pyridin-3-ylpyrazol-5-yl)carbamate |
| PubChem CID | 90359753 |
| Molecular Formula | C14H18N4O2S |
| Molecular Weight | 306.39 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | 2-methylsulfanylethyl N-methyl-N-(1-methyl-3-pyridin-3-ylpyrazol-5-yl)carbamate |
| SMILES | CSCCOC(=O)N(C)c1cc(-c2cccnc2)nn1C |
| InChI | InChI=1S/C14H18N4O2S/c1-17(14(19)20-7-8-21-3)13-9-12(16-18(13)2)11-5-4-6-15-10-11/h4-6,9-10H,7-8H2,1-3H3 |
| InChIKey | COFYQBSFMRVWTK-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.39 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-methylsulfanylethyl N-methyl-N-(1-methyl-3-pyridin-3-ylpyrazol-5-yl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylsulfanylethyl N-methyl-N-(1-methyl-3-pyridin-3-ylpyrazol-5-yl)carbamate?
The IUPAC name of 2-methylsulfanylethyl N-methyl-N-(1-methyl-3-pyridin-3-ylpyrazol-5-yl)carbamate (CID 90359753) is 2-methylsulfanylethyl N-methyl-N-(1-methyl-3-pyridin-3-ylpyrazol-5-yl)carbamate.
What is the SMILES notation for 2-methylsulfanylethyl N-methyl-N-(1-methyl-3-pyridin-3-ylpyrazol-5-yl)carbamate?
The canonical SMILES for 2-methylsulfanylethyl N-methyl-N-(1-methyl-3-pyridin-3-ylpyrazol-5-yl)carbamate is CSCCOC(=O)N(C)c1cc(-c2cccnc2)nn1C.
What is the InChIKey of 2-methylsulfanylethyl N-methyl-N-(1-methyl-3-pyridin-3-ylpyrazol-5-yl)carbamate?
The InChIKey is COFYQBSFMRVWTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18N4O2S/c1-17(14(19)20-7-8-21-3)13-9-12(16-18(13)2)11-5-4-6-15-10-11/h4-6,9-10H,7-8H2,1-3H3.
What are the key properties of 2-methylsulfanylethyl N-methyl-N-(1-methyl-3-pyridin-3-ylpyrazol-5-yl)carbamate?
2-methylsulfanylethyl N-methyl-N-(1-methyl-3-pyridin-3-ylpyrazol-5-yl)carbamate has a molecular weight of 306.39 g/mol, XLogP of 2.42, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylsulfanylethyl N-methyl-N-(1-methyl-3-pyridin-3-ylpyrazol-5-yl)carbamate is sourced from PubChem (CID 90359753), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).