C17H22ClN5O2S — CID 118945713
S-(2-methylpropyl) N-[(1-chloro-3-pyridin-3-ylpyrazol-5-yl)-methylcarbamoyl]-N-ethylcarbamothioate (PubChem CID 118945713) has the molecular formula C17H22ClN5O2S and a molecular weight of 395.92 g/mol. Its IUPAC name is S-(2-methylpropyl) N-[(1-chloro-3-pyridin-3-ylpyrazol-5-yl)-methylcarbamoyl]-N-ethylcarbamothioate.
| Compound Name | S-(2-methylpropyl) N-[(1-chloro-3-pyridin-3-ylpyrazol-5-yl)-methylcarbamoyl]-N-ethylcarbamothioate |
|---|---|
| PubChem CID | 118945713 |
| Molecular Formula | C17H22ClN5O2S |
| Molecular Weight | 395.92 g/mol |
| Exact Mass | 395.12 |
| IUPAC Name | S-(2-methylpropyl) N-[(1-chloro-3-pyridin-3-ylpyrazol-5-yl)-methylcarbamoyl]-N-ethylcarbamothioate |
| SMILES | CCN(C(=O)SCC(C)C)C(=O)N(C)c1cc(-c2cccnc2)nn1Cl |
| InChI | InChI=1S/C17H22ClN5O2S/c1-5-22(17(25)26-11-12(2)3)16(24)21(4)15-9-14(20-23(15)18)13-7-6-8-19-10-13/h6-10,12H,5,11H2,1-4H3 |
| InChIKey | VQLLWMOFUVYSBH-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 71.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.92 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|