C28H40N6O2 — CID 90362781
4-[2-(4-hydroxybutylamino)-5-[4-[(4-methylpiperazin-1-yl)methyl]phenyl]pyrrolo[2,3-d]pyrimidin-7-yl]cyclohexan-1-ol (PubChem CID 90362781) has the molecular formula C28H40N6O2 and a molecular weight of 492.67 g/mol. Its IUPAC name is 4-[2-(4-hydroxybutylamino)-5-[4-[(4-methylpiperazin-1-yl)methyl]phenyl]pyrrolo[2,3-d]pyrimidin-7-yl]cyclohexan-1-ol.
| Compound Name | 4-[2-(4-hydroxybutylamino)-5-[4-[(4-methylpiperazin-1-yl)methyl]phenyl]pyrrolo[2,3-d]pyrimidin-7-yl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 90362781 |
| Molecular Formula | C28H40N6O2 |
| Molecular Weight | 492.67 g/mol |
| Exact Mass | 492.32 |
| IUPAC Name | 4-[2-(4-hydroxybutylamino)-5-[4-[(4-methylpiperazin-1-yl)methyl]phenyl]pyrrolo[2,3-d]pyrimidin-7-yl]cyclohexan-1-ol |
| SMILES | CN1CCN(Cc2ccc(-c3cn(C4CCC(O)CC4)c4nc(NCCCCO)ncc34)cc2)CC1 |
| InChI | InChI=1S/C28H40N6O2/c1-32-13-15-33(16-14-32)19-21-4-6-22(7-5-21)26-20-34(23-8-10-24(36)11-9-23)27-25(26)18-30-28(31-27)29-12-2-3-17-35/h4-7,18,20,23-24,35-36H,2-3,8-17,19H2,1H3,(H,29,30,31) |
| InChIKey | MIYIUVBGBPRNLG-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 89.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.67 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|