C20H22N4O4S — CID 9036331
5-[2,5-dimethyl-3-[(E)-2-(4-nitrophenyl)sulfonylethenyl]pyrrol-1-yl]-1-propan-2-ylpyrazole (PubChem CID 9036331) has the molecular formula C20H22N4O4S and a molecular weight of 414.49 g/mol. Its IUPAC name is 5-[2,5-dimethyl-3-[(E)-2-(4-nitrophenyl)sulfonylethenyl]pyrrol-1-yl]-1-propan-2-ylpyrazole.
| Compound Name | 5-[2,5-dimethyl-3-[(E)-2-(4-nitrophenyl)sulfonylethenyl]pyrrol-1-yl]-1-propan-2-ylpyrazole |
|---|---|
| PubChem CID | 9036331 |
| Molecular Formula | C20H22N4O4S |
| Molecular Weight | 414.49 g/mol |
| Exact Mass | 414.14 |
| IUPAC Name | 5-[2,5-dimethyl-3-[(E)-2-(4-nitrophenyl)sulfonylethenyl]pyrrol-1-yl]-1-propan-2-ylpyrazole |
| SMILES | Cc1cc(/C=C/S(=O)(=O)c2ccc([N+](=O)[O-])cc2)c(C)n1-c1ccnn1C(C)C |
| InChI | InChI=1S/C20H22N4O4S/c1-14(2)23-20(9-11-21-23)22-15(3)13-17(16(22)4)10-12-29(27,28)19-7-5-18(6-8-19)24(25)26/h5-14H,1-4H3/b12-10+ |
| InChIKey | GOUWYLJFEMIYQQ-ZRDIBKRKSA-N |
| XLogP | 4.22 |
| TPSA | 100.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.49 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|