C15H14O2S — CID 90363401
1-(3-methylphenyl)-4-thiophen-2-ylbutane-1,4-dione (PubChem CID 90363401) has the molecular formula C15H14O2S and a molecular weight of 258.34 g/mol. Its IUPAC name is 1-(3-methylphenyl)-4-thiophen-2-ylbutane-1,4-dione.
| Compound Name | 1-(3-methylphenyl)-4-thiophen-2-ylbutane-1,4-dione |
|---|---|
| PubChem CID | 90363401 |
| Molecular Formula | C15H14O2S |
| Molecular Weight | 258.34 g/mol |
| Exact Mass | 258.07 |
| IUPAC Name | 1-(3-methylphenyl)-4-thiophen-2-ylbutane-1,4-dione |
| SMILES | Cc1cccc(C(=O)CCC(=O)c2cccs2)c1 |
| InChI | InChI=1S/C15H14O2S/c1-11-4-2-5-12(10-11)13(16)7-8-14(17)15-6-3-9-18-15/h2-6,9-10H,7-8H2,1H3 |
| InChIKey | ASKAZAOJKNSKEL-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.34 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |