C12H10N2O2S — CID 90363831
1-pyrimidin-5-yl-4-thiophen-2-ylbutane-1,4-dione (PubChem CID 90363831) has the molecular formula C12H10N2O2S and a molecular weight of 246.29 g/mol. Its IUPAC name is 1-pyrimidin-5-yl-4-thiophen-2-ylbutane-1,4-dione.
| Compound Name | 1-pyrimidin-5-yl-4-thiophen-2-ylbutane-1,4-dione |
|---|---|
| PubChem CID | 90363831 |
| Molecular Formula | C12H10N2O2S |
| Molecular Weight | 246.29 g/mol |
| Exact Mass | 246.05 |
| IUPAC Name | 1-pyrimidin-5-yl-4-thiophen-2-ylbutane-1,4-dione |
| SMILES | O=C(CCC(=O)c1cccs1)c1cncnc1 |
| InChI | InChI=1S/C12H10N2O2S/c15-10(9-6-13-8-14-7-9)3-4-11(16)12-2-1-5-17-12/h1-2,5-8H,3-4H2 |
| InChIKey | LSGDFXSMABHDOQ-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 59.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.29 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |