C9H9N3OS — CID 12960128
1-thiophen-2-yl-3-(1,2,4-triazol-1-yl)propan-1-one (PubChem CID 12960128) has the molecular formula C9H9N3OS and a molecular weight of 207.26 g/mol. Its IUPAC name is 1-thiophen-2-yl-3-(1,2,4-triazol-1-yl)propan-1-one.
| Compound Name | 1-thiophen-2-yl-3-(1,2,4-triazol-1-yl)propan-1-one |
|---|---|
| PubChem CID | 12960128 |
| Molecular Formula | C9H9N3OS |
| Molecular Weight | 207.26 g/mol |
| Exact Mass | 207.05 |
| IUPAC Name | 1-thiophen-2-yl-3-(1,2,4-triazol-1-yl)propan-1-one |
| SMILES | O=C(CCn1cncn1)c1cccs1 |
| InChI | InChI=1S/C9H9N3OS/c13-8(9-2-1-5-14-9)3-4-12-7-10-6-11-12/h1-2,5-7H,3-4H2 |
| InChIKey | HCUHKYCMVBJATK-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.26 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |