C19H17N3O4S2 — CID 170859379
naphthalene-1-sulfonic acid;1-thiophen-2-yl-3-(1,2,4-triazol-1-yl)propan-1-one (PubChem CID 170859379) has the molecular formula C19H17N3O4S2 and a molecular weight of 415.50 g/mol. Its IUPAC name is naphthalene-1-sulfonic acid;1-thiophen-2-yl-3-(1,2,4-triazol-1-yl)propan-1-one.
| Compound Name | naphthalene-1-sulfonic acid;1-thiophen-2-yl-3-(1,2,4-triazol-1-yl)propan-1-one |
|---|---|
| PubChem CID | 170859379 |
| Molecular Formula | C19H17N3O4S2 |
| Molecular Weight | 415.50 g/mol |
| Exact Mass | 415.07 |
| IUPAC Name | naphthalene-1-sulfonic acid;1-thiophen-2-yl-3-(1,2,4-triazol-1-yl)propan-1-one |
| SMILES | O=C(CCn1cncn1)c1cccs1.O=S(=O)(O)c1cccc2ccccc12 |
| InChI | InChI=1S/C10H8O3S.C9H9N3OS/c11-14(12,13)10-7-3-5-8-4-1-2-6-9(8)10;13-8(9-2-1-5-14-9)3-4-12-7-10-6-11-12/h1-7H,(H,11,12,13);1-2,5-7H,3-4H2 |
| InChIKey | DJKPUPFSDBTLKS-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 102.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.50 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|