C22H17N3O5 — CID 9036377
4-nitro-N'-[(E)-3-(3-phenoxyphenyl)prop-2-enoyl]benzohydrazide (PubChem CID 9036377) has the molecular formula C22H17N3O5 and a molecular weight of 403.39 g/mol. Its IUPAC name is 4-nitro-N'-[(E)-3-(3-phenoxyphenyl)prop-2-enoyl]benzohydrazide.
| Compound Name | 4-nitro-N'-[(E)-3-(3-phenoxyphenyl)prop-2-enoyl]benzohydrazide |
|---|---|
| PubChem CID | 9036377 |
| Molecular Formula | C22H17N3O5 |
| Molecular Weight | 403.39 g/mol |
| Exact Mass | 403.12 |
| IUPAC Name | 4-nitro-N'-[(E)-3-(3-phenoxyphenyl)prop-2-enoyl]benzohydrazide |
| SMILES | O=C(/C=C/c1cccc(Oc2ccccc2)c1)NNC(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C22H17N3O5/c26-21(23-24-22(27)17-10-12-18(13-11-17)25(28)29)14-9-16-5-4-8-20(15-16)30-19-6-2-1-3-7-19/h1-15H,(H,23,26)(H,24,27)/b14-9+ |
| InChIKey | YMDVPNURYZYZTF-NTEUORMPSA-N |
| XLogP | 3.86 |
| TPSA | 110.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.39 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|