C22H28F2N6O3S — CID 90365988
(1S,2R,3S,5R)-3-(difluoromethyl)-5-[[2-(2-ethoxyethylamino)-6-methyl-5-(4-methyl-[1,3]thiazolo[4,5-c]pyridin-2-yl)pyrimidin-4-yl]amino]cyclopentane-1,2-diol (PubChem CID 90365988) has the molecular formula C22H28F2N6O3S and a molecular weight of 494.57 g/mol. Its IUPAC name is (1S,2R,3S,5R)-3-(difluoromethyl)-5-[[2-(2-ethoxyethylamino)-6-methyl-5-(4-methyl-[1,3]thiazolo[4,5-c]pyridin-2-yl)pyrimidin-4-yl]amino]cyclopentane-1,2-diol.
| Compound Name | (1S,2R,3S,5R)-3-(difluoromethyl)-5-[[2-(2-ethoxyethylamino)-6-methyl-5-(4-methyl-[1,3]thiazolo[4,5-c]pyridin-2-yl)pyrimidin-4-yl]amino]cyclopentane-1,2-diol |
|---|---|
| PubChem CID | 90365988 |
| Molecular Formula | C22H28F2N6O3S |
| Molecular Weight | 494.57 g/mol |
| Exact Mass | 494.19 |
| IUPAC Name | (1S,2R,3S,5R)-3-(difluoromethyl)-5-[[2-(2-ethoxyethylamino)-6-methyl-5-(4-methyl-[1,3]thiazolo[4,5-c]pyridin-2-yl)pyrimidin-4-yl]amino]cyclopentane-1,2-diol |
| SMILES | CCOCCNc1nc(C)c(-c2nc3c(C)nccc3s2)c(N[C@@H]2C[C@H](C(F)F)[C@@H](O)[C@H]2O)n1 |
| InChI | InChI=1S/C22H28F2N6O3S/c1-4-33-8-7-26-22-27-10(2)15(21-29-16-11(3)25-6-5-14(16)34-21)20(30-22)28-13-9-12(19(23)24)17(31)18(13)32/h5-6,12-13,17-19,31-32H,4,7-9H2,1-3H3,(H2,26,27,28,30)/t12-,13+,17+,18-/m0/s1 |
| InChIKey | SFNGJCVHNFSWED-DECQCQTCSA-N |
| XLogP | 3.00 |
| TPSA | 125.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.57 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|