About 2-iodo-1-methylazetidine
2-iodo-1-methylazetidine (PubChem CID 90368179) has the molecular formula C4H8IN
and a molecular weight of 197.02 g/mol. Its IUPAC name is 2-iodo-1-methylazetidine.
Molecular Properties
| Compound Name | 2-iodo-1-methylazetidine |
| PubChem CID | 90368179 |
| Molecular Formula | C4H8IN |
| Molecular Weight | 197.02 g/mol |
| Exact Mass | 196.97 |
| IUPAC Name | 2-iodo-1-methylazetidine |
| SMILES | CN1CCC1I |
| InChI | InChI=1S/C4H8IN/c1-6-3-2-4(6)5/h4H,2-3H2,1H3 |
| InChIKey | QDZFOEJWQHLEJH-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.02 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 2-iodo-1-methylazetidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-iodo-1-methylazetidine?
The IUPAC name of 2-iodo-1-methylazetidine (CID 90368179) is 2-iodo-1-methylazetidine.
What is the SMILES notation for 2-iodo-1-methylazetidine?
The canonical SMILES for 2-iodo-1-methylazetidine is CN1CCC1I.
What is the InChIKey of 2-iodo-1-methylazetidine?
The InChIKey is QDZFOEJWQHLEJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8IN/c1-6-3-2-4(6)5/h4H,2-3H2,1H3.
What are the key properties of 2-iodo-1-methylazetidine?
2-iodo-1-methylazetidine has a molecular weight of 197.02 g/mol, XLogP of 1.08, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-iodo-1-methylazetidine is sourced from PubChem (CID 90368179), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).